C11H25NO2S — CID 106729692
N,2-diethyl-4-propan-2-ylsulfonylbutan-1-amine (PubChem CID 106729692) has the molecular formula C11H25NO2S and a molecular weight of 235.39 g/mol. Its IUPAC name is N,2-diethyl-4-propan-2-ylsulfonylbutan-1-amine.
| Compound Name | N,2-diethyl-4-propan-2-ylsulfonylbutan-1-amine |
|---|---|
| PubChem CID | 106729692 |
| Molecular Formula | C11H25NO2S |
| Molecular Weight | 235.39 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | N,2-diethyl-4-propan-2-ylsulfonylbutan-1-amine |
| SMILES | CCNCC(CC)CCS(=O)(=O)C(C)C |
| InChI | InChI=1S/C11H25NO2S/c1-5-11(9-12-6-2)7-8-15(13,14)10(3)4/h10-12H,5-9H2,1-4H3 |
| InChIKey | LKFYVEQFCGLLBM-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.39 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |