About ethane;N-ethyl-2-propylpentan-1-amine;pentane
ethane;N-ethyl-2-propylpentan-1-amine;pentane (PubChem CID 143708977) has the molecular formula C17H41N
and a molecular weight of 259.52 g/mol. Its IUPAC name is ethane;N-ethyl-2-propylpentan-1-amine;pentane.
Molecular Properties
| Compound Name | ethane;N-ethyl-2-propylpentan-1-amine;pentane |
| PubChem CID | 143708977 |
| Molecular Formula | C17H41N |
| Molecular Weight | 259.52 g/mol |
| Exact Mass | 259.32 |
| IUPAC Name | ethane;N-ethyl-2-propylpentan-1-amine;pentane |
| SMILES | CC.CCCC(CCC)CNCC.CCCCC |
| InChI | InChI=1S/C10H23N.C5H12.C2H6/c1-4-7-10(8-5-2)9-11-6-3;1-3-5-4-2;1-2/h10-11H,4-9H2,1-3H3;3-5H2,1-2H3;1-2H3 |
| InChIKey | YXURLSFEIKHXEK-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 259.52 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;N-ethyl-2-propylpentan-1-amine;pentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-ethyl-2-propylpentan-1-amine;pentane?
The IUPAC name of ethane;N-ethyl-2-propylpentan-1-amine;pentane (CID 143708977) is ethane;N-ethyl-2-propylpentan-1-amine;pentane.
What is the SMILES notation for ethane;N-ethyl-2-propylpentan-1-amine;pentane?
The canonical SMILES for ethane;N-ethyl-2-propylpentan-1-amine;pentane is CC.CCCC(CCC)CNCC.CCCCC.
What is the InChIKey of ethane;N-ethyl-2-propylpentan-1-amine;pentane?
The InChIKey is YXURLSFEIKHXEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23N.C5H12.C2H6/c1-4-7-10(8-5-2)9-11-6-3;1-3-5-4-2;1-2/h10-11H,4-9H2,1-3H3;3-5H2,1-2H3;1-2H3.
What are the key properties of ethane;N-ethyl-2-propylpentan-1-amine;pentane?
ethane;N-ethyl-2-propylpentan-1-amine;pentane has a molecular weight of 259.52 g/mol, XLogP of 6.03, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-ethyl-2-propylpentan-1-amine;pentane is sourced from PubChem (CID 143708977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).