C8H19F3N2 — CID 143427394
N-ethyl-N',N'-dimethylethane-1,2-diamine;1,1,1-trifluoroethane (PubChem CID 143427394) has the molecular formula C8H19F3N2 and a molecular weight of 200.25 g/mol. Its IUPAC name is N-ethyl-N',N'-dimethylethane-1,2-diamine;1,1,1-trifluoroethane.
| Compound Name | N-ethyl-N',N'-dimethylethane-1,2-diamine;1,1,1-trifluoroethane |
|---|---|
| PubChem CID | 143427394 |
| Molecular Formula | C8H19F3N2 |
| Molecular Weight | 200.25 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | N-ethyl-N',N'-dimethylethane-1,2-diamine;1,1,1-trifluoroethane |
| SMILES | CC(F)(F)F.CCNCCN(C)C |
| InChI | InChI=1S/C6H16N2.C2H3F3/c1-4-7-5-6-8(2)3;1-2(3,4)5/h7H,4-6H2,1-3H3;1H3 |
| InChIKey | QQMMJBJTEVVOCH-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.25 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|