C13H24F6N2 — CID 177295871
N,N'-ditert-butyl-1,1,2,2,3,3-hexafluoropentane-1,5-diamine (PubChem CID 177295871) has the molecular formula C13H24F6N2 and a molecular weight of 322.34 g/mol. Its IUPAC name is N,N'-ditert-butyl-1,1,2,2,3,3-hexafluoropentane-1,5-diamine.
| Compound Name | N,N'-ditert-butyl-1,1,2,2,3,3-hexafluoropentane-1,5-diamine |
|---|---|
| PubChem CID | 177295871 |
| Molecular Formula | C13H24F6N2 |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | N,N'-ditert-butyl-1,1,2,2,3,3-hexafluoropentane-1,5-diamine |
| SMILES | CC(C)(C)NCCC(F)(F)C(F)(F)C(F)(F)NC(C)(C)C |
| InChI | InChI=1S/C13H24F6N2/c1-9(2,3)20-8-7-11(14,15)12(16,17)13(18,19)21-10(4,5)6/h20-21H,7-8H2,1-6H3 |
| InChIKey | FGMHIBITONCAKP-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|