C12H18F10N2 — CID 87730183
N,N'-bis(2,2,3,3,3-pentafluoropropyl)hexane-1,6-diamine (PubChem CID 87730183) has the molecular formula C12H18F10N2 and a molecular weight of 380.27 g/mol. Its IUPAC name is N,N'-bis(2,2,3,3,3-pentafluoropropyl)hexane-1,6-diamine.
| Compound Name | N,N'-bis(2,2,3,3,3-pentafluoropropyl)hexane-1,6-diamine |
|---|---|
| PubChem CID | 87730183 |
| Molecular Formula | C12H18F10N2 |
| Molecular Weight | 380.27 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | N,N'-bis(2,2,3,3,3-pentafluoropropyl)hexane-1,6-diamine |
| SMILES | FC(F)(F)C(F)(F)CNCCCCCCNCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H18F10N2/c13-9(14,11(17,18)19)7-23-5-3-1-2-4-6-24-8-10(15,16)12(20,21)22/h23-24H,1-8H2 |
| InChIKey | SLQBYLKZVQQEKP-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.27 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|