C10H19F5N2 — CID 113410451
N'-tert-butyl-N-(2,2,3,3,3-pentafluoropropyl)propane-1,3-diamine (PubChem CID 113410451) has the molecular formula C10H19F5N2 and a molecular weight of 262.27 g/mol. Its IUPAC name is N'-tert-butyl-N-(2,2,3,3,3-pentafluoropropyl)propane-1,3-diamine.
| Compound Name | N'-tert-butyl-N-(2,2,3,3,3-pentafluoropropyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 113410451 |
| Molecular Formula | C10H19F5N2 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | N'-tert-butyl-N-(2,2,3,3,3-pentafluoropropyl)propane-1,3-diamine |
| SMILES | CC(C)(C)NCCCNCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H19F5N2/c1-8(2,3)17-6-4-5-16-7-9(11,12)10(13,14)15/h16-17H,4-7H2,1-3H3 |
| InChIKey | ZPAQOZXDDSBGEJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|