C20H37F7N2 — CID 142528808
N-(2-cyclobutyl-2,2-difluoroethyl)pentan-1-amine;4-methyl-N-(2,2,3,3,3-pentafluoropropyl)pentan-1-amine (PubChem CID 142528808) has the molecular formula C20H37F7N2 and a molecular weight of 438.52 g/mol. Its IUPAC name is N-(2-cyclobutyl-2,2-difluoroethyl)pentan-1-amine;4-methyl-N-(2,2,3,3,3-pentafluoropropyl)pentan-1-amine.
| Compound Name | N-(2-cyclobutyl-2,2-difluoroethyl)pentan-1-amine;4-methyl-N-(2,2,3,3,3-pentafluoropropyl)pentan-1-amine |
|---|---|
| PubChem CID | 142528808 |
| Molecular Formula | C20H37F7N2 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.28 |
| IUPAC Name | N-(2-cyclobutyl-2,2-difluoroethyl)pentan-1-amine;4-methyl-N-(2,2,3,3,3-pentafluoropropyl)pentan-1-amine |
| SMILES | CC(C)CCCNCC(F)(F)C(F)(F)F.CCCCCNCC(F)(F)C1CCC1 |
| InChI | InChI=1S/C11H21F2N.C9H16F5N/c1-2-3-4-8-14-9-11(12,13)10-6-5-7-10;1-7(2)4-3-5-15-6-8(10,11)9(12,13)14/h10,14H,2-9H2,1H3;7,15H,3-6H2,1-2H3 |
| InChIKey | NAIKRVZOPMSNQP-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|