About 4-(bromomethyl)-1,1-difluorocyclohexane;(4,4-difluorocyclohexyl)methanol
4-(bromomethyl)-1,1-difluorocyclohexane;(4,4-difluorocyclohexyl)methanol (PubChem CID 159319848) has the molecular formula C14H23BrF4O
and a molecular weight of 363.23 g/mol. Its IUPAC name is 4-(bromomethyl)-1,1-difluorocyclohexane;(4,4-difluorocyclohexyl)methanol.
Molecular Properties
| Compound Name | 4-(bromomethyl)-1,1-difluorocyclohexane;(4,4-difluorocyclohexyl)methanol |
| PubChem CID | 159319848 |
| Molecular Formula | C14H23BrF4O |
| Molecular Weight | 363.23 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 4-(bromomethyl)-1,1-difluorocyclohexane;(4,4-difluorocyclohexyl)methanol |
| SMILES | FC1(F)CCC(CBr)CC1.OCC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C7H11BrF2.C7H12F2O/c8-5-6-1-3-7(9,10)4-2-6;8-7(9)3-1-6(5-10)2-4-7/h6H,1-5H2;6,10H,1-5H2 |
| InChIKey | LDPSZTHERFWESA-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.23 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(bromomethyl)-1,1-difluorocyclohexane;(4,4-difluorocyclohexyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(bromomethyl)-1,1-difluorocyclohexane;(4,4-difluorocyclohexyl)methanol?
The IUPAC name of 4-(bromomethyl)-1,1-difluorocyclohexane;(4,4-difluorocyclohexyl)methanol (CID 159319848) is 4-(bromomethyl)-1,1-difluorocyclohexane;(4,4-difluorocyclohexyl)methanol.
What is the SMILES notation for 4-(bromomethyl)-1,1-difluorocyclohexane;(4,4-difluorocyclohexyl)methanol?
The canonical SMILES for 4-(bromomethyl)-1,1-difluorocyclohexane;(4,4-difluorocyclohexyl)methanol is FC1(F)CCC(CBr)CC1.OCC1CCC(F)(F)CC1.
What is the InChIKey of 4-(bromomethyl)-1,1-difluorocyclohexane;(4,4-difluorocyclohexyl)methanol?
The InChIKey is LDPSZTHERFWESA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11BrF2.C7H12F2O/c8-5-6-1-3-7(9,10)4-2-6;8-7(9)3-1-6(5-10)2-4-7/h6H,1-5H2;6,10H,1-5H2.
What are the key properties of 4-(bromomethyl)-1,1-difluorocyclohexane;(4,4-difluorocyclohexyl)methanol?
4-(bromomethyl)-1,1-difluorocyclohexane;(4,4-difluorocyclohexyl)methanol has a molecular weight of 363.23 g/mol, XLogP of 5.01, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(bromomethyl)-1,1-difluorocyclohexane;(4,4-difluorocyclohexyl)methanol is sourced from PubChem (CID 159319848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).