C14H23BrF4O — CID 159319848
4-(bromomethyl)-1,1-difluorocyclohexane;(4,4-difluorocyclohexyl)methanol (PubChem CID 159319848) has the molecular formula C14H23BrF4O and a molecular weight of 363.23 g/mol. Its IUPAC name is 4-(bromomethyl)-1,1-difluorocyclohexane;(4,4-difluorocyclohexyl)methanol.
| Compound Name | 4-(bromomethyl)-1,1-difluorocyclohexane;(4,4-difluorocyclohexyl)methanol |
|---|---|
| PubChem CID | 159319848 |
| Molecular Formula | C14H23BrF4O |
| Molecular Weight | 363.23 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 4-(bromomethyl)-1,1-difluorocyclohexane;(4,4-difluorocyclohexyl)methanol |
| SMILES | FC1(F)CCC(CBr)CC1.OCC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C7H11BrF2.C7H12F2O/c8-5-6-1-3-7(9,10)4-2-6;8-7(9)3-1-6(5-10)2-4-7/h6H,1-5H2;6,10H,1-5H2 |
| InChIKey | LDPSZTHERFWESA-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.23 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|