C11H19ClF2 — CID 130487710
3-(2-chloro-3-methylbutyl)-1,1-difluorocyclohexane (PubChem CID 130487710) has the molecular formula C11H19ClF2 and a molecular weight of 224.72 g/mol. Its IUPAC name is 3-(2-chloro-3-methylbutyl)-1,1-difluorocyclohexane.
| Compound Name | 3-(2-chloro-3-methylbutyl)-1,1-difluorocyclohexane |
|---|---|
| PubChem CID | 130487710 |
| Molecular Formula | C11H19ClF2 |
| Molecular Weight | 224.72 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 3-(2-chloro-3-methylbutyl)-1,1-difluorocyclohexane |
| SMILES | CC(C)C(Cl)CC1CCCC(F)(F)C1 |
| InChI | InChI=1S/C11H19ClF2/c1-8(2)10(12)6-9-4-3-5-11(13,14)7-9/h8-10H,3-7H2,1-2H3 |
| InChIKey | ZICPLZSZZNCQDR-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.72 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|