C7H11ClF2O2S — CID 124709989
[(1S)-3,3-difluorocyclohexyl]methanesulfonyl chloride (PubChem CID 124709989) has the molecular formula C7H11ClF2O2S and a molecular weight of 232.68 g/mol. Its IUPAC name is [(1S)-3,3-difluorocyclohexyl]methanesulfonyl chloride.
| Compound Name | [(1S)-3,3-difluorocyclohexyl]methanesulfonyl chloride |
|---|---|
| PubChem CID | 124709989 |
| Molecular Formula | C7H11ClF2O2S |
| Molecular Weight | 232.68 g/mol |
| Exact Mass | 232.01 |
| IUPAC Name | [(1S)-3,3-difluorocyclohexyl]methanesulfonyl chloride |
| SMILES | O=S(=O)(Cl)C[C@H]1CCCC(F)(F)C1 |
| InChI | InChI=1S/C7H11ClF2O2S/c8-13(11,12)5-6-2-1-3-7(9,10)4-6/h6H,1-5H2/t6-/m0/s1 |
| InChIKey | QSPHSERFSNKLAW-LURJTMIESA-N |
| XLogP | 2.38 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.68 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |