C10H17F2NO — CID 130487410
3-[(3,3-difluorocyclohexyl)methyl]azetidin-3-ol (PubChem CID 130487410) has the molecular formula C10H17F2NO and a molecular weight of 205.25 g/mol. Its IUPAC name is 3-[(3,3-difluorocyclohexyl)methyl]azetidin-3-ol.
| Compound Name | 3-[(3,3-difluorocyclohexyl)methyl]azetidin-3-ol |
|---|---|
| PubChem CID | 130487410 |
| Molecular Formula | C10H17F2NO |
| Molecular Weight | 205.25 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 3-[(3,3-difluorocyclohexyl)methyl]azetidin-3-ol |
| SMILES | OC1(CC2CCCC(F)(F)C2)CNC1 |
| InChI | InChI=1S/C10H17F2NO/c11-10(12)3-1-2-8(5-10)4-9(14)6-13-7-9/h8,13-14H,1-7H2 |
| InChIKey | JWPPGMQJFUWSAY-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.25 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |