C14H27F2NO — CID 114225157
4-(3,3-difluorocyclohexyl)-N-(2-methoxyethyl)-3-methylbutan-2-amine (PubChem CID 114225157) has the molecular formula C14H27F2NO and a molecular weight of 263.37 g/mol. Its IUPAC name is 4-(3,3-difluorocyclohexyl)-N-(2-methoxyethyl)-3-methylbutan-2-amine.
| Compound Name | 4-(3,3-difluorocyclohexyl)-N-(2-methoxyethyl)-3-methylbutan-2-amine |
|---|---|
| PubChem CID | 114225157 |
| Molecular Formula | C14H27F2NO |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.21 |
| IUPAC Name | 4-(3,3-difluorocyclohexyl)-N-(2-methoxyethyl)-3-methylbutan-2-amine |
| SMILES | COCCNC(C)C(C)CC1CCCC(F)(F)C1 |
| InChI | InChI=1S/C14H27F2NO/c1-11(12(2)17-7-8-18-3)9-13-5-4-6-14(15,16)10-13/h11-13,17H,4-10H2,1-3H3 |
| InChIKey | ZVZCTTACBCXZIF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|