C15H24F2O2 — CID 114224662
1-cyclohexyl-3-(3,3-difluorocyclohexyl)-1-hydroxypropan-2-one (PubChem CID 114224662) has the molecular formula C15H24F2O2 and a molecular weight of 274.35 g/mol. Its IUPAC name is 1-cyclohexyl-3-(3,3-difluorocyclohexyl)-1-hydroxypropan-2-one.
| Compound Name | 1-cyclohexyl-3-(3,3-difluorocyclohexyl)-1-hydroxypropan-2-one |
|---|---|
| PubChem CID | 114224662 |
| Molecular Formula | C15H24F2O2 |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 1-cyclohexyl-3-(3,3-difluorocyclohexyl)-1-hydroxypropan-2-one |
| SMILES | O=C(CC1CCCC(F)(F)C1)C(O)C1CCCCC1 |
| InChI | InChI=1S/C15H24F2O2/c16-15(17)8-4-5-11(10-15)9-13(18)14(19)12-6-2-1-3-7-12/h11-12,14,19H,1-10H2 |
| InChIKey | NCHCRWLEIIXQBN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |