C12H20F2O3S — CID 114224985
methyl 3-[(3,3-difluorocyclohexyl)methylsulfinyl]butanoate (PubChem CID 114224985) has the molecular formula C12H20F2O3S and a molecular weight of 282.35 g/mol. Its IUPAC name is methyl 3-[(3,3-difluorocyclohexyl)methylsulfinyl]butanoate.
| Compound Name | methyl 3-[(3,3-difluorocyclohexyl)methylsulfinyl]butanoate |
|---|---|
| PubChem CID | 114224985 |
| Molecular Formula | C12H20F2O3S |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | methyl 3-[(3,3-difluorocyclohexyl)methylsulfinyl]butanoate |
| SMILES | COC(=O)CC(C)S(=O)CC1CCCC(F)(F)C1 |
| InChI | InChI=1S/C12H20F2O3S/c1-9(6-11(15)17-2)18(16)8-10-4-3-5-12(13,14)7-10/h9-10H,3-8H2,1-2H3 |
| InChIKey | ROTCFTQUUFJJNA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |