methyl 3-[(3,3-difluorocyclohexyl)methylsulfinyl]butanoate

C12H20F2O3S — CID 114224985

IUPACmethyl 3-[(3,3-difluorocyclohexyl)methylsulfinyl]butanoate
SMILESCOC(=O)CC(C)S(=O)CC1CCCC(F)(F)C1
InChIInChI=1S/C12H20F2O3S/c1-9(6-11(15)17-2)18(16)8-10-4-3-5-12(13,14)7-10/h9-10H,3-8H2,1-2H3
InChIKeyROTCFTQUUFJJNA-UHFFFAOYSA-N
MW282.35 g/mol
LogP2.51
Rot. Bonds5

About methyl 3-[(3,3-difluorocyclohexyl)methylsulfinyl]butanoate

methyl 3-[(3,3-difluorocyclohexyl)methylsulfinyl]butanoate (PubChem CID 114224985) has the molecular formula C12H20F2O3S and a molecular weight of 282.35 g/mol. Its IUPAC name is methyl 3-[(3,3-difluorocyclohexyl)methylsulfinyl]butanoate.

Molecular Properties

Compound Namemethyl 3-[(3,3-difluorocyclohexyl)methylsulfinyl]butanoate
PubChem CID114224985
Molecular FormulaC12H20F2O3S
Molecular Weight282.35 g/mol
Exact Mass282.11
IUPAC Namemethyl 3-[(3,3-difluorocyclohexyl)methylsulfinyl]butanoate
SMILESCOC(=O)CC(C)S(=O)CC1CCCC(F)(F)C1
InChIInChI=1S/C12H20F2O3S/c1-9(6-11(15)17-2)18(16)8-10-4-3-5-12(13,14)7-10/h9-10H,3-8H2,1-2H3
InChIKeyROTCFTQUUFJJNA-UHFFFAOYSA-N
XLogP2.51
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500282.35
LogP ≤ 52.51
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 3-[(3,3-difluorocyclohexyl)methylsulfinyl]butanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-[(3,3-difluorocyclohexyl)methylsulfinyl]butanoate?
The IUPAC name of methyl 3-[(3,3-difluorocyclohexyl)methylsulfinyl]butanoate (CID 114224985) is methyl 3-[(3,3-difluorocyclohexyl)methylsulfinyl]butanoate.
What is the SMILES notation for methyl 3-[(3,3-difluorocyclohexyl)methylsulfinyl]butanoate?
The canonical SMILES for methyl 3-[(3,3-difluorocyclohexyl)methylsulfinyl]butanoate is COC(=O)CC(C)S(=O)CC1CCCC(F)(F)C1.
What is the InChIKey of methyl 3-[(3,3-difluorocyclohexyl)methylsulfinyl]butanoate?
The InChIKey is ROTCFTQUUFJJNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20F2O3S/c1-9(6-11(15)17-2)18(16)8-10-4-3-5-12(13,14)7-10/h9-10H,3-8H2,1-2H3.
What are the key properties of methyl 3-[(3,3-difluorocyclohexyl)methylsulfinyl]butanoate?
methyl 3-[(3,3-difluorocyclohexyl)methylsulfinyl]butanoate has a molecular weight of 282.35 g/mol, XLogP of 2.51, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(3,3-difluorocyclohexyl)methylsulfinyl]butanoate is sourced from PubChem (CID 114224985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).