C11H19F2N2O2- — CID 154458537
N-[2-amino-3-(4,4-difluorocyclohexyl)propyl]-N-methylcarbamate (PubChem CID 154458537) has the molecular formula C11H19F2N2O2- and a molecular weight of 249.28 g/mol. Its IUPAC name is N-[2-amino-3-(4,4-difluorocyclohexyl)propyl]-N-methylcarbamate.
| Compound Name | N-[2-amino-3-(4,4-difluorocyclohexyl)propyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 154458537 |
| Molecular Formula | C11H19F2N2O2- |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | N-[2-amino-3-(4,4-difluorocyclohexyl)propyl]-N-methylcarbamate |
| SMILES | CN(CC(N)CC1CCC(F)(F)CC1)C(=O)[O-] |
| InChI | InChI=1S/C11H20F2N2O2/c1-15(10(16)17)7-9(14)6-8-2-4-11(12,13)5-3-8/h8-9H,2-7,14H2,1H3,(H,16,17)/p-1 |
| InChIKey | AYFJJVFYJSKNNI-UHFFFAOYSA-M |
| XLogP | 0.80 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |