C16H32N2 — CID 114264928
1-N,3-dicyclohexyl-1-N-methylpropane-1,2-diamine (PubChem CID 114264928) has the molecular formula C16H32N2 and a molecular weight of 252.45 g/mol. Its IUPAC name is 1-N,3-dicyclohexyl-1-N-methylpropane-1,2-diamine.
| Compound Name | 1-N,3-dicyclohexyl-1-N-methylpropane-1,2-diamine |
|---|---|
| PubChem CID | 114264928 |
| Molecular Formula | C16H32N2 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.26 |
| IUPAC Name | 1-N,3-dicyclohexyl-1-N-methylpropane-1,2-diamine |
| SMILES | CN(CC(N)CC1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C16H32N2/c1-18(16-10-6-3-7-11-16)13-15(17)12-14-8-4-2-5-9-14/h14-16H,2-13,17H2,1H3 |
| InChIKey | XHDDHHSPNBGNNM-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |