C14H22F2INO3 — CID 175397089
tert-butyl N-[1-(4,4-difluorocyclohexyl)-3-iodo-2-oxopropyl]carbamate (PubChem CID 175397089) has the molecular formula C14H22F2INO3 and a molecular weight of 417.23 g/mol. Its IUPAC name is tert-butyl N-[1-(4,4-difluorocyclohexyl)-3-iodo-2-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[1-(4,4-difluorocyclohexyl)-3-iodo-2-oxopropyl]carbamate |
|---|---|
| PubChem CID | 175397089 |
| Molecular Formula | C14H22F2INO3 |
| Molecular Weight | 417.23 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | tert-butyl N-[1-(4,4-difluorocyclohexyl)-3-iodo-2-oxopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(C(=O)CI)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C14H22F2INO3/c1-13(2,3)21-12(20)18-11(10(19)8-17)9-4-6-14(15,16)7-5-9/h9,11H,4-8H2,1-3H3,(H,18,20) |
| InChIKey | KQGOSWYOPLIKSK-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.23 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|