C15H28FNO5S — CID 86639447
[(2S)-3-(1-fluorocyclohexyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] methanesulfonate (PubChem CID 86639447) has the molecular formula C15H28FNO5S and a molecular weight of 353.46 g/mol. Its IUPAC name is [(2S)-3-(1-fluorocyclohexyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] methanesulfonate.
| Compound Name | [(2S)-3-(1-fluorocyclohexyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] methanesulfonate |
|---|---|
| PubChem CID | 86639447 |
| Molecular Formula | C15H28FNO5S |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | [(2S)-3-(1-fluorocyclohexyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] methanesulfonate |
| SMILES | CC(C)(C)OC(=O)N[C@H](COS(C)(=O)=O)CC1(F)CCCCC1 |
| InChI | InChI=1S/C15H28FNO5S/c1-14(2,3)22-13(18)17-12(11-21-23(4,19)20)10-15(16)8-6-5-7-9-15/h12H,5-11H2,1-4H3,(H,17,18)/t12-/m0/s1 |
| InChIKey | CHIXVCWKZBDCCU-LBPRGKRZSA-N |
| XLogP | 2.92 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|