C17H32N2O4Si — CID 122379651
tert-butyl (2R,3S)-2-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-trimethylsilylpent-4-ynoate (PubChem CID 122379651) has the molecular formula C17H32N2O4Si and a molecular weight of 356.54 g/mol. Its IUPAC name is tert-butyl (2R,3S)-2-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-trimethylsilylpent-4-ynoate.
| Compound Name | tert-butyl (2R,3S)-2-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-trimethylsilylpent-4-ynoate |
|---|---|
| PubChem CID | 122379651 |
| Molecular Formula | C17H32N2O4Si |
| Molecular Weight | 356.54 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | tert-butyl (2R,3S)-2-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-trimethylsilylpent-4-ynoate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C#C[Si](C)(C)C)[C@@H](N)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H32N2O4Si/c1-16(2,3)22-14(20)13(18)12(10-11-24(7,8)9)19-15(21)23-17(4,5)6/h12-13H,18H2,1-9H3,(H,19,21)/t12-,13+/m0/s1 |
| InChIKey | FXQJKWMAEQNNFF-QWHCGFSZSA-N |
| XLogP | 2.43 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.54 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|