C19H34N2O4 — CID 122379648
tert-butyl (2R,3S)-2-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]dec-4-ynoate (PubChem CID 122379648) has the molecular formula C19H34N2O4 and a molecular weight of 354.49 g/mol. Its IUPAC name is tert-butyl (2R,3S)-2-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]dec-4-ynoate.
| Compound Name | tert-butyl (2R,3S)-2-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]dec-4-ynoate |
|---|---|
| PubChem CID | 122379648 |
| Molecular Formula | C19H34N2O4 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.25 |
| IUPAC Name | tert-butyl (2R,3S)-2-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]dec-4-ynoate |
| SMILES | CCCCCC#C[C@H](NC(=O)OC(C)(C)C)[C@@H](N)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H34N2O4/c1-8-9-10-11-12-13-14(21-17(23)25-19(5,6)7)15(20)16(22)24-18(2,3)4/h14-15H,8-11,20H2,1-7H3,(H,21,23)/t14-,15+/m0/s1 |
| InChIKey | FSRFVDAKSDPEPA-LSDHHAIUSA-N |
| XLogP | 3.13 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|