C20H34N2O4 — CID 122379649
tert-butyl (2R,3S)-2-amino-5-cyclohexyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-ynoate (PubChem CID 122379649) has the molecular formula C20H34N2O4 and a molecular weight of 366.50 g/mol. Its IUPAC name is tert-butyl (2R,3S)-2-amino-5-cyclohexyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-ynoate.
| Compound Name | tert-butyl (2R,3S)-2-amino-5-cyclohexyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-ynoate |
|---|---|
| PubChem CID | 122379649 |
| Molecular Formula | C20H34N2O4 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.25 |
| IUPAC Name | tert-butyl (2R,3S)-2-amino-5-cyclohexyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-ynoate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C#CC1CCCCC1)[C@@H](N)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H34N2O4/c1-19(2,3)25-17(23)16(21)15(22-18(24)26-20(4,5)6)13-12-14-10-8-7-9-11-14/h14-16H,7-11,21H2,1-6H3,(H,22,24)/t15-,16+/m0/s1 |
| InChIKey | QRVZVBGCYBUSAH-JKSUJKDBSA-N |
| XLogP | 3.13 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|