C21H31NO5 — CID 134948434
ethyl (1S)-1-[(1S)-3-cyclopentyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]prop-2-ynyl]-2-oxocyclopentane-1-carboxylate (PubChem CID 134948434) has the molecular formula C21H31NO5 and a molecular weight of 377.48 g/mol. Its IUPAC name is ethyl (1S)-1-[(1S)-3-cyclopentyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]prop-2-ynyl]-2-oxocyclopentane-1-carboxylate.
| Compound Name | ethyl (1S)-1-[(1S)-3-cyclopentyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]prop-2-ynyl]-2-oxocyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 134948434 |
| Molecular Formula | C21H31NO5 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | ethyl (1S)-1-[(1S)-3-cyclopentyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]prop-2-ynyl]-2-oxocyclopentane-1-carboxylate |
| SMILES | CCOC(=O)[C@]1([C@H](C#CC2CCCC2)NC(=O)OC(C)(C)C)CCCC1=O |
| InChI | InChI=1S/C21H31NO5/c1-5-26-18(24)21(14-8-11-17(21)23)16(13-12-15-9-6-7-10-15)22-19(25)27-20(2,3)4/h15-16H,5-11,14H2,1-4H3,(H,22,25)/t16-,21-/m0/s1 |
| InChIKey | KRNWGCRZIDTVFV-KKSFZXQISA-N |
| XLogP | 3.38 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|