C16H27NO5 — CID 146433223
methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[(1S)-2-oxocyclohexyl]butanoate (PubChem CID 146433223) has the molecular formula C16H27NO5 and a molecular weight of 313.39 g/mol. Its IUPAC name is methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[(1S)-2-oxocyclohexyl]butanoate.
| Compound Name | methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[(1S)-2-oxocyclohexyl]butanoate |
|---|---|
| PubChem CID | 146433223 |
| Molecular Formula | C16H27NO5 |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[(1S)-2-oxocyclohexyl]butanoate |
| SMILES | COC(=O)[C@H](CC[C@@H]1CCCCC1=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H27NO5/c1-16(2,3)22-15(20)17-12(14(19)21-4)10-9-11-7-5-6-8-13(11)18/h11-12H,5-10H2,1-4H3,(H,17,20)/t11-,12-/m0/s1 |
| InChIKey | ZOCBFLIHTGGPBY-RYUDHWBXSA-N |
| XLogP | 2.59 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |