C15H25NO6Si — CID 178158247
3-acetyloxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-trimethylsilylpent-4-ynoic acid (PubChem CID 178158247) has the molecular formula C15H25NO6Si and a molecular weight of 343.45 g/mol. Its IUPAC name is 3-acetyloxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-trimethylsilylpent-4-ynoic acid.
| Compound Name | 3-acetyloxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-trimethylsilylpent-4-ynoic acid |
|---|---|
| PubChem CID | 178158247 |
| Molecular Formula | C15H25NO6Si |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 3-acetyloxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-trimethylsilylpent-4-ynoic acid |
| SMILES | CC(=O)OC(C#C[Si](C)(C)C)C(NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C15H25NO6Si/c1-10(17)21-11(8-9-23(5,6)7)12(13(18)19)16-14(20)22-15(2,3)4/h11-12H,1-7H3,(H,16,20)(H,18,19) |
| InChIKey | LOFOGVBNBLCNQP-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|