C23H47NO3Si2 — CID 102122528
tert-butyl N-[(3R)-1-trimethylsilyl-6-tri(propan-2-yl)silyloxyhex-1-yn-3-yl]carbamate (PubChem CID 102122528) has the molecular formula C23H47NO3Si2 and a molecular weight of 441.81 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-trimethylsilyl-6-tri(propan-2-yl)silyloxyhex-1-yn-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-trimethylsilyl-6-tri(propan-2-yl)silyloxyhex-1-yn-3-yl]carbamate |
|---|---|
| PubChem CID | 102122528 |
| Molecular Formula | C23H47NO3Si2 |
| Molecular Weight | 441.81 g/mol |
| Exact Mass | 441.31 |
| IUPAC Name | tert-butyl N-[(3R)-1-trimethylsilyl-6-tri(propan-2-yl)silyloxyhex-1-yn-3-yl]carbamate |
| SMILES | CC(C)[Si](OCCC[C@H](C#C[Si](C)(C)C)NC(=O)OC(C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C23H47NO3Si2/c1-18(2)29(19(3)4,20(5)6)26-16-13-14-21(15-17-28(10,11)12)24-22(25)27-23(7,8)9/h18-21H,13-14,16H2,1-12H3,(H,24,25)/t21-/m1/s1 |
| InChIKey | FMOLUJHXXNPDBP-OAQYLSRUSA-N |
| XLogP | 6.73 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.81 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|