C13H23NO2 — CID 129203415
tert-butyl N-[(3R)-6-methylhept-1-yn-3-yl]carbamate (PubChem CID 129203415) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is tert-butyl N-[(3R)-6-methylhept-1-yn-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-6-methylhept-1-yn-3-yl]carbamate |
|---|---|
| PubChem CID | 129203415 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | tert-butyl N-[(3R)-6-methylhept-1-yn-3-yl]carbamate |
| SMILES | C#C[C@@H](CCC(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H23NO2/c1-7-11(9-8-10(2)3)14-12(15)16-13(4,5)6/h1,10-11H,8-9H2,2-6H3,(H,14,15)/t11-/m0/s1 |
| InChIKey | NDUYLKOUYFVVKL-NSHDSACASA-N |
| XLogP | 2.95 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|