C21H43NO4Si — CID 19697569
tert-butyl N-[4-methyl-1-oxo-6-tri(propan-2-yl)silyloxyhexan-2-yl]carbamate (PubChem CID 19697569) has the molecular formula C21H43NO4Si and a molecular weight of 401.66 g/mol. Its IUPAC name is tert-butyl N-[4-methyl-1-oxo-6-tri(propan-2-yl)silyloxyhexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-methyl-1-oxo-6-tri(propan-2-yl)silyloxyhexan-2-yl]carbamate |
|---|---|
| PubChem CID | 19697569 |
| Molecular Formula | C21H43NO4Si |
| Molecular Weight | 401.66 g/mol |
| Exact Mass | 401.30 |
| IUPAC Name | tert-butyl N-[4-methyl-1-oxo-6-tri(propan-2-yl)silyloxyhexan-2-yl]carbamate |
| SMILES | CC(CCO[Si](C(C)C)(C(C)C)C(C)C)CC(C=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H43NO4Si/c1-15(2)27(16(3)4,17(5)6)25-12-11-18(7)13-19(14-23)22-20(24)26-21(8,9)10/h14-19H,11-13H2,1-10H3,(H,22,24) |
| InChIKey | NHMVDNUBTKBODW-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.66 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|