C29H58N2O5Si — CID 86752102
tert-butyl N-[(4S,5S,7S)-2-(butylcarbamoyl)-4-hydroxy-7-methyl-9-tri(propan-2-yl)silyloxynon-1-en-5-yl]carbamate (PubChem CID 86752102) has the molecular formula C29H58N2O5Si and a molecular weight of 542.88 g/mol. Its IUPAC name is tert-butyl N-[(4S,5S,7S)-2-(butylcarbamoyl)-4-hydroxy-7-methyl-9-tri(propan-2-yl)silyloxynon-1-en-5-yl]carbamate.
| Compound Name | tert-butyl N-[(4S,5S,7S)-2-(butylcarbamoyl)-4-hydroxy-7-methyl-9-tri(propan-2-yl)silyloxynon-1-en-5-yl]carbamate |
|---|---|
| PubChem CID | 86752102 |
| Molecular Formula | C29H58N2O5Si |
| Molecular Weight | 542.88 g/mol |
| Exact Mass | 542.41 |
| IUPAC Name | tert-butyl N-[(4S,5S,7S)-2-(butylcarbamoyl)-4-hydroxy-7-methyl-9-tri(propan-2-yl)silyloxynon-1-en-5-yl]carbamate |
| SMILES | C=C(C[C@H](O)[C@H](C[C@H](C)CCO[Si](C(C)C)(C(C)C)C(C)C)NC(=O)OC(C)(C)C)C(=O)NCCCC |
| InChI | InChI=1S/C29H58N2O5Si/c1-13-14-16-30-27(33)24(9)19-26(32)25(31-28(34)36-29(10,11)12)18-23(8)15-17-35-37(20(2)3,21(4)5)22(6)7/h20-23,25-26,32H,9,13-19H2,1-8,10-12H3,(H,30,33)(H,31,34)/t23-,25+,26+/m1/s1 |
| InChIKey | ZOJAVFQUYLPCSJ-AFESJLNVSA-N |
| XLogP | 6.71 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.88 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|