C13H23FeNO2Si+ — CID 134900358
[1-[[1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]amino]-3-trimethylsilylprop-2-ynylidene]iron(1+) (PubChem CID 134900358) has the molecular formula C13H23FeNO2Si+ and a molecular weight of 309.26 g/mol. Its IUPAC name is [1-[[1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]amino]-3-trimethylsilylprop-2-ynylidene]iron(1+).
| Compound Name | [1-[[1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]amino]-3-trimethylsilylprop-2-ynylidene]iron(1+) |
|---|---|
| PubChem CID | 134900358 |
| Molecular Formula | C13H23FeNO2Si+ |
| Molecular Weight | 309.26 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | [1-[[1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]amino]-3-trimethylsilylprop-2-ynylidene]iron(1+) |
| SMILES | CC(NC(=[Fe+])C#C[Si](C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H23NO2Si.Fe/c1-11(12(15)16-13(2,3)4)14-9-8-10-17(5,6)7;/h11,14H,1-7H3;/q;+1 |
| InChIKey | CJPGNYAXKHTNNT-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.26 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|