C8H16N2O2S — CID 141124888
tert-butyl 2-(carbamothioylamino)propanoate (PubChem CID 141124888) has the molecular formula C8H16N2O2S and a molecular weight of 204.29 g/mol. Its IUPAC name is tert-butyl 2-(carbamothioylamino)propanoate.
| Compound Name | tert-butyl 2-(carbamothioylamino)propanoate |
|---|---|
| PubChem CID | 141124888 |
| Molecular Formula | C8H16N2O2S |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | tert-butyl 2-(carbamothioylamino)propanoate |
| SMILES | CC(NC(N)=S)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C8H16N2O2S/c1-5(10-7(9)13)6(11)12-8(2,3)4/h5H,1-4H3,(H3,9,10,13) |
| InChIKey | FQUNDOOFIWHATJ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|