C20H38N2O3SSi — CID 11796101
tert-butyl N-[(1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-4-methyl-1-(1,3-thiazol-2-yl)pentan-2-yl]carbamate (PubChem CID 11796101) has the molecular formula C20H38N2O3SSi and a molecular weight of 414.69 g/mol. Its IUPAC name is tert-butyl N-[(1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-4-methyl-1-(1,3-thiazol-2-yl)pentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-4-methyl-1-(1,3-thiazol-2-yl)pentan-2-yl]carbamate |
|---|---|
| PubChem CID | 11796101 |
| Molecular Formula | C20H38N2O3SSi |
| Molecular Weight | 414.69 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | tert-butyl N-[(1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-4-methyl-1-(1,3-thiazol-2-yl)pentan-2-yl]carbamate |
| SMILES | CC(C)C[C@H](NC(=O)OC(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)c1nccs1 |
| InChI | InChI=1S/C20H38N2O3SSi/c1-14(2)13-15(22-18(23)24-19(3,4)5)16(17-21-11-12-26-17)25-27(9,10)20(6,7)8/h11-12,14-16H,13H2,1-10H3,(H,22,23)/t15-,16-/m0/s1 |
| InChIKey | IMGPNVYNUANLBK-HOTGVXAUSA-N |
| XLogP | 6.15 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.69 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|