C26H43NO5Si — CID 54130199
(2R,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenyl-2-prop-2-enylhexanoic acid (PubChem CID 54130199) has the molecular formula C26H43NO5Si and a molecular weight of 477.72 g/mol. Its IUPAC name is (2R,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenyl-2-prop-2-enylhexanoic acid.
| Compound Name | (2R,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenyl-2-prop-2-enylhexanoic acid |
|---|---|
| PubChem CID | 54130199 |
| Molecular Formula | C26H43NO5Si |
| Molecular Weight | 477.72 g/mol |
| Exact Mass | 477.29 |
| IUPAC Name | (2R,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenyl-2-prop-2-enylhexanoic acid |
| SMILES | C=CC[C@H](C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C26H43NO5Si/c1-10-14-20(23(28)29)18-22(32-33(8,9)26(5,6)7)21(17-19-15-12-11-13-16-19)27-24(30)31-25(2,3)4/h10-13,15-16,20-22H,1,14,17-18H2,2-9H3,(H,27,30)(H,28,29)/t20-,21+,22+/m1/s1 |
| InChIKey | NTUNZNABIZBSBN-FSSWDIPSSA-N |
| XLogP | 6.18 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.72 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|