C34H49N3O4Si — CID 11758159
tert-butyl N-[(2S,3S,5R)-5-(5-acetyl-1H-imidazol-2-yl)-3-[tert-butyl(dimethyl)silyl]oxy-1,6-diphenylhexan-2-yl]carbamate (PubChem CID 11758159) has the molecular formula C34H49N3O4Si and a molecular weight of 591.87 g/mol. Its IUPAC name is tert-butyl N-[(2S,3S,5R)-5-(5-acetyl-1H-imidazol-2-yl)-3-[tert-butyl(dimethyl)silyl]oxy-1,6-diphenylhexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3S,5R)-5-(5-acetyl-1H-imidazol-2-yl)-3-[tert-butyl(dimethyl)silyl]oxy-1,6-diphenylhexan-2-yl]carbamate |
|---|---|
| PubChem CID | 11758159 |
| Molecular Formula | C34H49N3O4Si |
| Molecular Weight | 591.87 g/mol |
| Exact Mass | 591.35 |
| IUPAC Name | tert-butyl N-[(2S,3S,5R)-5-(5-acetyl-1H-imidazol-2-yl)-3-[tert-butyl(dimethyl)silyl]oxy-1,6-diphenylhexan-2-yl]carbamate |
| SMILES | CC(=O)c1cnc([C@H](Cc2ccccc2)C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](Cc2ccccc2)NC(=O)OC(C)(C)C)[nH]1 |
| InChI | InChI=1S/C34H49N3O4Si/c1-24(38)29-23-35-31(36-29)27(20-25-16-12-10-13-17-25)22-30(41-42(8,9)34(5,6)7)28(21-26-18-14-11-15-19-26)37-32(39)40-33(2,3)4/h10-19,23,27-28,30H,20-22H2,1-9H3,(H,35,36)(H,37,39)/t27-,28+,30+/m1/s1 |
| InChIKey | HMPHQAPLVSGYPN-UNRZKBSHSA-N |
| XLogP | 7.86 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.87 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|