C27H31N3O4 — CID 89220386
prop-1-en-2-yl N-[(3S)-5-(5-acetyl-1H-imidazol-2-yl)-3-hydroxy-1,6-diphenylhexan-2-yl]carbamate (PubChem CID 89220386) has the molecular formula C27H31N3O4 and a molecular weight of 461.56 g/mol. Its IUPAC name is prop-1-en-2-yl N-[(3S)-5-(5-acetyl-1H-imidazol-2-yl)-3-hydroxy-1,6-diphenylhexan-2-yl]carbamate.
| Compound Name | prop-1-en-2-yl N-[(3S)-5-(5-acetyl-1H-imidazol-2-yl)-3-hydroxy-1,6-diphenylhexan-2-yl]carbamate |
|---|---|
| PubChem CID | 89220386 |
| Molecular Formula | C27H31N3O4 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | prop-1-en-2-yl N-[(3S)-5-(5-acetyl-1H-imidazol-2-yl)-3-hydroxy-1,6-diphenylhexan-2-yl]carbamate |
| SMILES | C=C(C)OC(=O)NC(Cc1ccccc1)[C@@H](O)CC(Cc1ccccc1)c1ncc(C(C)=O)[nH]1 |
| InChI | InChI=1S/C27H31N3O4/c1-18(2)34-27(33)30-23(15-21-12-8-5-9-13-21)25(32)16-22(14-20-10-6-4-7-11-20)26-28-17-24(29-26)19(3)31/h4-13,17,22-23,25,32H,1,14-16H2,2-3H3,(H,28,29)(H,30,33)/t22?,23?,25-/m0/s1 |
| InChIKey | MKKKLGORAUCRNW-RVMZIBIISA-N |
| XLogP | 4.56 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|