C27H32N2O4S — CID 54211451
tert-butyl N-[5-(5-formyl-1,3-thiazol-2-yl)-3-hydroxy-1,6-diphenylhexan-2-yl]carbamate (PubChem CID 54211451) has the molecular formula C27H32N2O4S and a molecular weight of 480.63 g/mol. Its IUPAC name is tert-butyl N-[5-(5-formyl-1,3-thiazol-2-yl)-3-hydroxy-1,6-diphenylhexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[5-(5-formyl-1,3-thiazol-2-yl)-3-hydroxy-1,6-diphenylhexan-2-yl]carbamate |
|---|---|
| PubChem CID | 54211451 |
| Molecular Formula | C27H32N2O4S |
| Molecular Weight | 480.63 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | tert-butyl N-[5-(5-formyl-1,3-thiazol-2-yl)-3-hydroxy-1,6-diphenylhexan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccccc1)C(O)CC(Cc1ccccc1)c1ncc(C=O)s1 |
| InChI | InChI=1S/C27H32N2O4S/c1-27(2,3)33-26(32)29-23(15-20-12-8-5-9-13-20)24(31)16-21(14-19-10-6-4-7-11-19)25-28-17-22(18-30)34-25/h4-13,17-18,21,23-24,31H,14-16H2,1-3H3,(H,29,32) |
| InChIKey | PWFRMGLBHCVFNE-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.63 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|