C30H45NO5Si — CID 173250910
(2R,4S,5S)-2-benzyl-4-(2,3-dimethylbutan-2-ylsilyloxy)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenylhexanoic acid (PubChem CID 173250910) has the molecular formula C30H45NO5Si and a molecular weight of 527.78 g/mol. Its IUPAC name is (2R,4S,5S)-2-benzyl-4-(2,3-dimethylbutan-2-ylsilyloxy)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenylhexanoic acid.
| Compound Name | (2R,4S,5S)-2-benzyl-4-(2,3-dimethylbutan-2-ylsilyloxy)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenylhexanoic acid |
|---|---|
| PubChem CID | 173250910 |
| Molecular Formula | C30H45NO5Si |
| Molecular Weight | 527.78 g/mol |
| Exact Mass | 527.31 |
| IUPAC Name | (2R,4S,5S)-2-benzyl-4-(2,3-dimethylbutan-2-ylsilyloxy)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenylhexanoic acid |
| SMILES | CC(C)C(C)(C)[SiH2]O[C@@H](C[C@@H](Cc1ccccc1)C(=O)O)[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H45NO5Si/c1-21(2)30(6,7)37-36-26(20-24(27(32)33)18-22-14-10-8-11-15-22)25(19-23-16-12-9-13-17-23)31-28(34)35-29(3,4)5/h8-17,21,24-26H,18-20,37H2,1-7H3,(H,31,34)(H,32,33)/t24-,25+,26+/m1/s1 |
| InChIKey | QDPGUXSIJACKCA-ZNZIZOMTSA-N |
| XLogP | 5.78 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.78 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|