C17H34N2O7Si — CID 19691482
5-[tert-butyl(dimethyl)silyl]oxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(nitromethyl)pentanoic acid (PubChem CID 19691482) has the molecular formula C17H34N2O7Si and a molecular weight of 406.55 g/mol. Its IUPAC name is 5-[tert-butyl(dimethyl)silyl]oxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(nitromethyl)pentanoic acid.
| Compound Name | 5-[tert-butyl(dimethyl)silyl]oxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(nitromethyl)pentanoic acid |
|---|---|
| PubChem CID | 19691482 |
| Molecular Formula | C17H34N2O7Si |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | 5-[tert-butyl(dimethyl)silyl]oxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(nitromethyl)pentanoic acid |
| SMILES | CC(C)(C)OC(=O)NC(CO[Si](C)(C)C(C)(C)C)C(CC(=O)O)C[N+](=O)[O-] |
| InChI | InChI=1S/C17H34N2O7Si/c1-16(2,3)26-15(22)18-13(11-25-27(7,8)17(4,5)6)12(9-14(20)21)10-19(23)24/h12-13H,9-11H2,1-8H3,(H,18,22)(H,20,21) |
| InChIKey | YSEDXOLIQPJRRV-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|