C23H38N2O8Si — CID 10300524
methyl (2S,3R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(3-nitrophenyl)methoxy]butanoate (PubChem CID 10300524) has the molecular formula C23H38N2O8Si and a molecular weight of 498.65 g/mol. Its IUPAC name is methyl (2S,3R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(3-nitrophenyl)methoxy]butanoate.
| Compound Name | methyl (2S,3R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(3-nitrophenyl)methoxy]butanoate |
|---|---|
| PubChem CID | 10300524 |
| Molecular Formula | C23H38N2O8Si |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | methyl (2S,3R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(3-nitrophenyl)methoxy]butanoate |
| SMILES | COC(=O)[C@@H](OCc1cccc([N+](=O)[O-])c1)[C@@H](CO[Si](C)(C)C(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H38N2O8Si/c1-22(2,3)33-21(27)24-18(15-32-34(8,9)23(4,5)6)19(20(26)30-7)31-14-16-11-10-12-17(13-16)25(28)29/h10-13,18-19H,14-15H2,1-9H3,(H,24,27)/t18-,19+/m1/s1 |
| InChIKey | RHANOPUHSHQLGY-MOPGFXCFSA-N |
| XLogP | 4.57 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|