C21H26N2O5 — CID 175033495
tert-butyl N-[3-[(3-nitrophenyl)methoxy]-3-phenylpropyl]carbamate (PubChem CID 175033495) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is tert-butyl N-[3-[(3-nitrophenyl)methoxy]-3-phenylpropyl]carbamate.
| Compound Name | tert-butyl N-[3-[(3-nitrophenyl)methoxy]-3-phenylpropyl]carbamate |
|---|---|
| PubChem CID | 175033495 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | tert-butyl N-[3-[(3-nitrophenyl)methoxy]-3-phenylpropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(OCc1cccc([N+](=O)[O-])c1)c1ccccc1 |
| InChI | InChI=1S/C21H26N2O5/c1-21(2,3)28-20(24)22-13-12-19(17-9-5-4-6-10-17)27-15-16-8-7-11-18(14-16)23(25)26/h4-11,14,19H,12-13,15H2,1-3H3,(H,22,24) |
| InChIKey | OAFOSZKURKZSPC-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|