C10H22N2O3 — CID 131733528
tert-butyl N-[(2R,3R)-3-amino-1-methoxybutan-2-yl]carbamate (PubChem CID 131733528) has the molecular formula C10H22N2O3 and a molecular weight of 218.30 g/mol. Its IUPAC name is tert-butyl N-[(2R,3R)-3-amino-1-methoxybutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3R)-3-amino-1-methoxybutan-2-yl]carbamate |
|---|---|
| PubChem CID | 131733528 |
| Molecular Formula | C10H22N2O3 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.16 |
| IUPAC Name | tert-butyl N-[(2R,3R)-3-amino-1-methoxybutan-2-yl]carbamate |
| SMILES | COC[C@H](NC(=O)OC(C)(C)C)[C@@H](C)N |
| InChI | InChI=1S/C10H22N2O3/c1-7(11)8(6-14-5)12-9(13)15-10(2,3)4/h7-8H,6,11H2,1-5H3,(H,12,13)/t7-,8+/m1/s1 |
| InChIKey | DAIWDSNRLMDMBA-SFYZADRCSA-N |
| XLogP | 0.87 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |