C28H43NO4 — CID 70432090
(Z)-7-[(1S,2S,3S,4R)-3-(hexoxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-N-(4-hydroxyphenyl)-2,2-dimethylhept-5-enamide (PubChem CID 70432090) has the molecular formula C28H43NO4 and a molecular weight of 457.66 g/mol. Its IUPAC name is (Z)-7-[(1S,2S,3S,4R)-3-(hexoxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-N-(4-hydroxyphenyl)-2,2-dimethylhept-5-enamide.
| Compound Name | (Z)-7-[(1S,2S,3S,4R)-3-(hexoxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-N-(4-hydroxyphenyl)-2,2-dimethylhept-5-enamide |
|---|---|
| PubChem CID | 70432090 |
| Molecular Formula | C28H43NO4 |
| Molecular Weight | 457.66 g/mol |
| Exact Mass | 457.32 |
| IUPAC Name | (Z)-7-[(1S,2S,3S,4R)-3-(hexoxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-N-(4-hydroxyphenyl)-2,2-dimethylhept-5-enamide |
| SMILES | CCCCCCOC[C@@H]1[C@H](C/C=C\CCC(C)(C)C(=O)Nc2ccc(O)cc2)[C@@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C28H43NO4/c1-4-5-6-10-19-32-20-24-23(25-16-17-26(24)33-25)11-8-7-9-18-28(2,3)27(31)29-21-12-14-22(30)15-13-21/h7-8,12-15,23-26,30H,4-6,9-11,16-20H2,1-3H3,(H,29,31)/b8-7-/t23-,24+,25-,26+/m0/s1 |
| InChIKey | JJDXCJKIYQVJQB-VSERKGTESA-N |
| XLogP | 6.47 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.66 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|