C29H44FNO4 — CID 57166012
(1S,2S,3S,4R)-2-[7-[(4-fluorophenyl)methoxy]-6,6-dimethyl-7-nitrosohept-2-enyl]-3-(hexoxymethyl)-7-oxabicyclo[2.2.1]heptane (PubChem CID 57166012) has the molecular formula C29H44FNO4 and a molecular weight of 489.67 g/mol. Its IUPAC name is (1S,2S,3S,4R)-2-[7-[(4-fluorophenyl)methoxy]-6,6-dimethyl-7-nitrosohept-2-enyl]-3-(hexoxymethyl)-7-oxabicyclo[2.2.1]heptane.
| Compound Name | (1S,2S,3S,4R)-2-[7-[(4-fluorophenyl)methoxy]-6,6-dimethyl-7-nitrosohept-2-enyl]-3-(hexoxymethyl)-7-oxabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 57166012 |
| Molecular Formula | C29H44FNO4 |
| Molecular Weight | 489.67 g/mol |
| Exact Mass | 489.33 |
| IUPAC Name | (1S,2S,3S,4R)-2-[7-[(4-fluorophenyl)methoxy]-6,6-dimethyl-7-nitrosohept-2-enyl]-3-(hexoxymethyl)-7-oxabicyclo[2.2.1]heptane |
| SMILES | CCCCCCOC[C@@H]1[C@H](CC=CCCC(C)(C)C(N=O)OCc2ccc(F)cc2)[C@@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C29H44FNO4/c1-4-5-6-10-19-33-21-25-24(26-16-17-27(25)35-26)11-8-7-9-18-29(2,3)28(31-32)34-20-22-12-14-23(30)15-13-22/h7-8,12-15,24-28H,4-6,9-11,16-21H2,1-3H3/t24-,25+,26-,27+,28?/m0/s1 |
| InChIKey | LEZAXOILRXOZBT-BSCDCSNMSA-N |
| XLogP | 7.58 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.67 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|