C25H45NO4 — CID 54243285
(1S,2S,3S,4R)-2-(6,6-dimethyl-7-nitroso-7-propoxyhept-2-enyl)-3-(hexoxymethyl)-7-oxabicyclo[2.2.1]heptane (PubChem CID 54243285) has the molecular formula C25H45NO4 and a molecular weight of 423.64 g/mol. Its IUPAC name is (1S,2S,3S,4R)-2-(6,6-dimethyl-7-nitroso-7-propoxyhept-2-enyl)-3-(hexoxymethyl)-7-oxabicyclo[2.2.1]heptane.
| Compound Name | (1S,2S,3S,4R)-2-(6,6-dimethyl-7-nitroso-7-propoxyhept-2-enyl)-3-(hexoxymethyl)-7-oxabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 54243285 |
| Molecular Formula | C25H45NO4 |
| Molecular Weight | 423.64 g/mol |
| Exact Mass | 423.33 |
| IUPAC Name | (1S,2S,3S,4R)-2-(6,6-dimethyl-7-nitroso-7-propoxyhept-2-enyl)-3-(hexoxymethyl)-7-oxabicyclo[2.2.1]heptane |
| SMILES | CCCCCCOC[C@@H]1[C@H](CC=CCCC(C)(C)C(N=O)OCCC)[C@@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C25H45NO4/c1-5-7-8-12-18-28-19-21-20(22-14-15-23(21)30-22)13-10-9-11-16-25(3,4)24(26-27)29-17-6-2/h9-10,20-24H,5-8,11-19H2,1-4H3/t20-,21+,22-,23+,24?/m0/s1 |
| InChIKey | QRMSUGIBXAGUHX-WBMBYIAYSA-N |
| XLogP | 6.65 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.64 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|