C28H38O4 — CID 70432031
4-[(Z)-5-[(1R,2R,3R,4S)-3-(hexoxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]pent-3-enoxy]naphthalen-1-ol (PubChem CID 70432031) has the molecular formula C28H38O4 and a molecular weight of 438.61 g/mol. Its IUPAC name is 4-[(Z)-5-[(1R,2R,3R,4S)-3-(hexoxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]pent-3-enoxy]naphthalen-1-ol.
| Compound Name | 4-[(Z)-5-[(1R,2R,3R,4S)-3-(hexoxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]pent-3-enoxy]naphthalen-1-ol |
|---|---|
| PubChem CID | 70432031 |
| Molecular Formula | C28H38O4 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.28 |
| IUPAC Name | 4-[(Z)-5-[(1R,2R,3R,4S)-3-(hexoxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]pent-3-enoxy]naphthalen-1-ol |
| SMILES | CCCCCCOC[C@H]1[C@@H](C/C=C\CCOc2ccc(O)c3ccccc23)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C28H38O4/c1-2-3-4-9-18-30-20-24-23(27-16-17-28(24)32-27)12-6-5-10-19-31-26-15-14-25(29)21-11-7-8-13-22(21)26/h5-8,11,13-15,23-24,27-29H,2-4,9-10,12,16-20H2,1H3/b6-5-/t23-,24+,27-,28+/m1/s1 |
| InChIKey | IHBPYIWOTDTPNR-FEQGAFODSA-N |
| XLogP | 6.65 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|