C23H40O4 — CID 54523522
(1S,2R,4R)-2-(hexoxymethyl)-3-[5-[(2S)-oxan-2-yl]oxypent-2-enyl]-7-oxabicyclo[2.2.1]heptane (PubChem CID 54523522) has the molecular formula C23H40O4 and a molecular weight of 380.57 g/mol. Its IUPAC name is (1S,2R,4R)-2-(hexoxymethyl)-3-[5-[(2S)-oxan-2-yl]oxypent-2-enyl]-7-oxabicyclo[2.2.1]heptane.
| Compound Name | (1S,2R,4R)-2-(hexoxymethyl)-3-[5-[(2S)-oxan-2-yl]oxypent-2-enyl]-7-oxabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 54523522 |
| Molecular Formula | C23H40O4 |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 380.29 |
| IUPAC Name | (1S,2R,4R)-2-(hexoxymethyl)-3-[5-[(2S)-oxan-2-yl]oxypent-2-enyl]-7-oxabicyclo[2.2.1]heptane |
| SMILES | CCCCCCOC[C@H]1C(CC=CCCO[C@H]2CCCCO2)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C23H40O4/c1-2-3-4-8-15-24-18-20-19(21-13-14-22(20)27-21)11-6-5-9-16-25-23-12-7-10-17-26-23/h5-6,19-23H,2-4,7-18H2,1H3/t19?,20-,21+,22-,23+/m0/s1 |
| InChIKey | YRNARCMMBJNSGW-ARHMPVJQSA-N |
| XLogP | 5.26 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|