C21H36O4 — CID 57117528
(2R)-7-[(1R,3R,4S)-3-(hexoxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-2-methylhept-5-enoic acid (PubChem CID 57117528) has the molecular formula C21H36O4 and a molecular weight of 352.52 g/mol. Its IUPAC name is (2R)-7-[(1R,3R,4S)-3-(hexoxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-2-methylhept-5-enoic acid.
| Compound Name | (2R)-7-[(1R,3R,4S)-3-(hexoxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-2-methylhept-5-enoic acid |
|---|---|
| PubChem CID | 57117528 |
| Molecular Formula | C21H36O4 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.26 |
| IUPAC Name | (2R)-7-[(1R,3R,4S)-3-(hexoxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-2-methylhept-5-enoic acid |
| SMILES | CCCCCCOC[C@H]1C(CC=CCC[C@@H](C)C(=O)O)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C21H36O4/c1-3-4-5-9-14-24-15-18-17(19-12-13-20(18)25-19)11-8-6-7-10-16(2)21(22)23/h6,8,16-20H,3-5,7,9-15H2,1-2H3,(H,22,23)/t16-,17?,18+,19-,20+/m1/s1 |
| InChIKey | SQUZVVJTFVIJPB-OWIYKUFQSA-N |
| XLogP | 4.82 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|