C25H46O3 — CID 54288167
7-[(1R,2R,3S,4S)-3-(4-hexoxybutyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-2,2-dimethylhept-5-en-1-ol (PubChem CID 54288167) has the molecular formula C25H46O3 and a molecular weight of 394.64 g/mol. Its IUPAC name is 7-[(1R,2R,3S,4S)-3-(4-hexoxybutyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-2,2-dimethylhept-5-en-1-ol.
| Compound Name | 7-[(1R,2R,3S,4S)-3-(4-hexoxybutyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-2,2-dimethylhept-5-en-1-ol |
|---|---|
| PubChem CID | 54288167 |
| Molecular Formula | C25H46O3 |
| Molecular Weight | 394.64 g/mol |
| Exact Mass | 394.34 |
| IUPAC Name | 7-[(1R,2R,3S,4S)-3-(4-hexoxybutyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-2,2-dimethylhept-5-en-1-ol |
| SMILES | CCCCCCOCCCC[C@H]1[C@@H](CC=CCCC(C)(C)CO)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C25H46O3/c1-4-5-6-11-18-27-19-12-9-14-22-21(23-15-16-24(22)28-23)13-8-7-10-17-25(2,3)20-26/h7-8,21-24,26H,4-6,9-20H2,1-3H3/t21-,22+,23-,24+/m1/s1 |
| InChIKey | RVQAHNIZGYCQQI-QPXUXIHVSA-N |
| XLogP | 6.29 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.64 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|