C20H37NO3S2 — CID 54368739
2-[4-[(1R,2R,3S,4S)-3-(hexylsulfanylmethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]butylsulfanyl]-N-hydroxy-N-methylacetamide (PubChem CID 54368739) has the molecular formula C20H37NO3S2 and a molecular weight of 403.65 g/mol. Its IUPAC name is 2-[4-[(1R,2R,3S,4S)-3-(hexylsulfanylmethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]butylsulfanyl]-N-hydroxy-N-methylacetamide.
| Compound Name | 2-[4-[(1R,2R,3S,4S)-3-(hexylsulfanylmethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]butylsulfanyl]-N-hydroxy-N-methylacetamide |
|---|---|
| PubChem CID | 54368739 |
| Molecular Formula | C20H37NO3S2 |
| Molecular Weight | 403.65 g/mol |
| Exact Mass | 403.22 |
| IUPAC Name | 2-[4-[(1R,2R,3S,4S)-3-(hexylsulfanylmethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]butylsulfanyl]-N-hydroxy-N-methylacetamide |
| SMILES | CCCCCCSC[C@H]1[C@@H](CCCCSCC(=O)N(C)O)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C20H37NO3S2/c1-3-4-5-7-12-25-14-17-16(18-10-11-19(17)24-18)9-6-8-13-26-15-20(22)21(2)23/h16-19,23H,3-15H2,1-2H3/t16-,17+,18-,19+/m1/s1 |
| InChIKey | URQMWNCTLFOLFD-HCXYKTFWSA-N |
| XLogP | 4.84 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.65 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|