C22H33NO3S2 — CID 54044938
5-[[(1S,2S,3R,4R)-3-(2-benzylsulfanylethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methylsulfanyl]-N-hydroxy-N-methylpentanamide (PubChem CID 54044938) has the molecular formula C22H33NO3S2 and a molecular weight of 423.64 g/mol. Its IUPAC name is 5-[[(1S,2S,3R,4R)-3-(2-benzylsulfanylethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methylsulfanyl]-N-hydroxy-N-methylpentanamide.
| Compound Name | 5-[[(1S,2S,3R,4R)-3-(2-benzylsulfanylethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methylsulfanyl]-N-hydroxy-N-methylpentanamide |
|---|---|
| PubChem CID | 54044938 |
| Molecular Formula | C22H33NO3S2 |
| Molecular Weight | 423.64 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 5-[[(1S,2S,3R,4R)-3-(2-benzylsulfanylethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methylsulfanyl]-N-hydroxy-N-methylpentanamide |
| SMILES | CN(O)C(=O)CCCCSC[C@H]1[C@@H](CCSCc2ccccc2)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C22H33NO3S2/c1-23(25)22(24)9-5-6-13-27-16-19-18(20-10-11-21(19)26-20)12-14-28-15-17-7-3-2-4-8-17/h2-4,7-8,18-21,25H,5-6,9-16H2,1H3/t18-,19+,20-,21+/m1/s1 |
| InChIKey | LOXAQMLFOUCKEC-MHTWAQMVSA-N |
| XLogP | 4.85 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.64 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|