C15H26O4S — CID 57082215
methyl 5-[[3-(2-hydroxyethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methylsulfanyl]pentanoate (PubChem CID 57082215) has the molecular formula C15H26O4S and a molecular weight of 302.44 g/mol. Its IUPAC name is methyl 5-[[3-(2-hydroxyethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methylsulfanyl]pentanoate.
| Compound Name | methyl 5-[[3-(2-hydroxyethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methylsulfanyl]pentanoate |
|---|---|
| PubChem CID | 57082215 |
| Molecular Formula | C15H26O4S |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | methyl 5-[[3-(2-hydroxyethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methylsulfanyl]pentanoate |
| SMILES | COC(=O)CCCCSCC1C2CCC(O2)C1CCO |
| InChI | InChI=1S/C15H26O4S/c1-18-15(17)4-2-3-9-20-10-12-11(7-8-16)13-5-6-14(12)19-13/h11-14,16H,2-10H2,1H3 |
| InChIKey | YEAXZLVKKSMOKL-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|